C14H13N3O — CID 39733479
2-[(5S)-3-pyridin-3-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol (PubChem CID 39733479) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(5S)-3-pyridin-3-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol.
| Compound Name | 2-[(5S)-3-pyridin-3-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 39733479 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(5S)-3-pyridin-3-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
| SMILES | Oc1ccccc1[C@@H]1CC(c2cccnc2)=NN1 |
| InChI | InChI=1S/C14H13N3O/c18-14-6-2-1-5-11(14)13-8-12(16-17-13)10-4-3-7-15-9-10/h1-7,9,13,17-18H,8H2/t13-/m0/s1 |
| InChIKey | GVHYUVUYNFYSNR-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|