C10H13N3O3S2 — CID 39740788
N-[(3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide (PubChem CID 39740788) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-[(3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 39740788 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N-[(3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
| SMILES | CCN1/C(=N/C(=O)CC#N)S[C@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C10H13N3O3S2/c1-2-13-7-5-18(15,16)6-8(7)17-10(13)12-9(14)3-4-11/h7-8H,2-3,5-6H2,1H3/b12-10-/t7-,8-/m0/s1 |
| InChIKey | YPAUJGKRRYVBIV-JDKLRLMGSA-N |
| XLogP | 0.02 |
| TPSA | 90.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|