C12H20N2O3S2 — CID 43838705
N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)pentanamide (PubChem CID 43838705) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)pentanamide.
| Compound Name | N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)pentanamide |
|---|---|
| PubChem CID | 43838705 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)pentanamide |
| SMILES | CCCCC(=O)/N=C1\SC2CS(=O)(=O)CC2N1CC |
| InChI | InChI=1S/C12H20N2O3S2/c1-3-5-6-11(15)13-12-14(4-2)9-7-19(16,17)8-10(9)18-12/h9-10H,3-8H2,1-2H3/b13-12- |
| InChIKey | PUSMJIUTUAHOAX-SEYXRHQNSA-N |
| XLogP | 1.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|