C11H16N2O3S2 — CID 43838711
N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)cyclopropanecarboxamide (PubChem CID 43838711) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)cyclopropanecarboxamide.
| Compound Name | N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43838711 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)cyclopropanecarboxamide |
| SMILES | CCN1/C(=N/C(=O)C2CC2)SC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C11H16N2O3S2/c1-2-13-8-5-18(15,16)6-9(8)17-11(13)12-10(14)7-3-4-7/h7-9H,2-6H2,1H3/b12-11- |
| InChIKey | OXWSSAZZMHKKJI-QXMHVHEDSA-N |
| XLogP | 0.51 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|