C24H36N4O5S2 — CID 39742004
tert-butyl N-[3-[[(3aR,6aS)-3-[4-(diethylamino)-2-methylphenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate (PubChem CID 39742004) has the molecular formula C24H36N4O5S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3aR,6aS)-3-[4-(diethylamino)-2-methylphenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(3aR,6aS)-3-[4-(diethylamino)-2-methylphenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 39742004 |
| Molecular Formula | C24H36N4O5S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | tert-butyl N-[3-[[(3aR,6aS)-3-[4-(diethylamino)-2-methylphenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
| SMILES | CCN(CC)c1ccc(N2/C(=N/C(=O)CCNC(=O)OC(C)(C)C)S[C@@H]3CS(=O)(=O)C[C@H]32)c(C)c1 |
| InChI | InChI=1S/C24H36N4O5S2/c1-7-27(8-2)17-9-10-18(16(3)13-17)28-19-14-35(31,32)15-20(19)34-22(28)26-21(29)11-12-25-23(30)33-24(4,5)6/h9-10,13,19-20H,7-8,11-12,14-15H2,1-6H3,(H,25,30)/b26-22-/t19-,20-/m1/s1 |
| InChIKey | TUPHRMRQAVQINI-IPAGSERISA-N |
| XLogP | 3.36 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|