C20H26FN3O5S2 — CID 39880028
tert-butyl N-[3-[[(3aR,6aR)-3-(3-fluoro-4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate (PubChem CID 39880028) has the molecular formula C20H26FN3O5S2 and a molecular weight of 471.58 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3aR,6aR)-3-(3-fluoro-4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(3aR,6aR)-3-(3-fluoro-4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 39880028 |
| Molecular Formula | C20H26FN3O5S2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | tert-butyl N-[3-[[(3aR,6aR)-3-(3-fluoro-4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(N2/C(=N/C(=O)CCNC(=O)OC(C)(C)C)S[C@H]3CS(=O)(=O)C[C@H]32)cc1F |
| InChI | InChI=1S/C20H26FN3O5S2/c1-12-5-6-13(9-14(12)21)24-15-10-31(27,28)11-16(15)30-18(24)23-17(25)7-8-22-19(26)29-20(2,3)4/h5-6,9,15-16H,7-8,10-11H2,1-4H3,(H,22,26)/b23-18-/t15-,16+/m1/s1 |
| InChIKey | WQCANZBHAPGNCV-WOWGLZSGSA-N |
| XLogP | 2.65 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|