C20H27N3O5S2 — CID 39741727
tert-butyl N-[2-[[(3aS,6aR)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate (PubChem CID 39741727) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3aS,6aR)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3aS,6aR)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 39741727 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl N-[2-[[(3aS,6aR)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
| SMILES | Cc1ccc(N2/C(=N/C(=O)CNC(=O)OC(C)(C)C)S[C@H]3CS(=O)(=O)C[C@@H]32)cc1C |
| InChI | InChI=1S/C20H27N3O5S2/c1-12-6-7-14(8-13(12)2)23-15-10-30(26,27)11-16(15)29-18(23)22-17(24)9-21-19(25)28-20(3,4)5/h6-8,15-16H,9-11H2,1-5H3,(H,21,25)/b22-18-/t15-,16-/m0/s1 |
| InChIKey | VNVHRVMSASWYPK-VHQKITAYSA-N |
| XLogP | 2.43 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|