C18H21Cl2N3O5S2 — CID 39878858
tert-butyl N-[2-[[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate (PubChem CID 39878858) has the molecular formula C18H21Cl2N3O5S2 and a molecular weight of 494.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 39878858 |
| Molecular Formula | C18H21Cl2N3O5S2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | tert-butyl N-[2-[[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O5S2/c1-18(2,3)28-17(25)21-7-14(24)22-16-23(15-10(19)5-4-6-11(15)20)12-8-30(26,27)9-13(12)29-16/h4-6,12-13H,7-9H2,1-3H3,(H,21,25)/b22-16-/t12-,13-/m0/s1 |
| InChIKey | LJPMKSJQGGDNNP-POGDUCCYSA-N |
| XLogP | 3.12 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|