C19H25N3O6S2 — CID 43837941
tert-butyl N-[2-[[3-(2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate (PubChem CID 43837941) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 43837941 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | tert-butyl N-[2-[[3-(2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
| SMILES | COc1ccccc1N1/C(=N/C(=O)CNC(=O)OC(C)(C)C)SC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C19H25N3O6S2/c1-19(2,3)28-18(24)20-9-16(23)21-17-22(12-7-5-6-8-14(12)27-4)13-10-30(25,26)11-15(13)29-17/h5-8,13,15H,9-11H2,1-4H3,(H,20,24)/b21-17- |
| InChIKey | GISIKHAXFNYUDL-FXBPSFAMSA-N |
| XLogP | 1.82 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|