C18H22IN3O5S2 — CID 43839065
tert-butyl N-[2-[[3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate (PubChem CID 43839065) has the molecular formula C18H22IN3O5S2 and a molecular weight of 551.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 43839065 |
| Molecular Formula | C18H22IN3O5S2 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.00 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)/N=C1\SC2CS(=O)(=O)CC2N1c1cccc(I)c1 |
| InChI | InChI=1S/C18H22IN3O5S2/c1-18(2,3)27-17(24)20-8-15(23)21-16-22(12-6-4-5-11(19)7-12)13-9-29(25,26)10-14(13)28-16/h4-7,13-14H,8-10H2,1-3H3,(H,20,24)/b21-16- |
| InChIKey | DMKLFHSAMJNWNC-PGMHBOJBSA-N |
| XLogP | 2.42 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|