C19H24ClN3O5S2 — CID 39882858
tert-butyl N-[3-[[(3aR,6aS)-3-(4-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate (PubChem CID 39882858) has the molecular formula C19H24ClN3O5S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3aR,6aS)-3-(4-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(3aR,6aS)-3-(4-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 39882858 |
| Molecular Formula | C19H24ClN3O5S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | tert-butyl N-[3-[[(3aR,6aS)-3-(4-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O5S2/c1-19(2,3)28-18(25)21-9-8-16(24)22-17-23(13-6-4-12(20)5-7-13)14-10-30(26,27)11-15(14)29-17/h4-7,14-15H,8-11H2,1-3H3,(H,21,25)/b22-17-/t14-,15-/m1/s1 |
| InChIKey | NHRGZGSXVBUXNX-QHJNZIPSSA-N |
| XLogP | 2.86 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|