C26H26N2O7S2 — CID 3976388
ethyl 4-(2-methylpropyl)-2-[[2-(3-nitro-4-phenylsulfanylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 3976388) has the molecular formula C26H26N2O7S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is ethyl 4-(2-methylpropyl)-2-[[2-(3-nitro-4-phenylsulfanylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2-methylpropyl)-2-[[2-(3-nitro-4-phenylsulfanylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3976388 |
| Molecular Formula | C26H26N2O7S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | ethyl 4-(2-methylpropyl)-2-[[2-(3-nitro-4-phenylsulfanylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC(C)C)csc1NC(=O)COC(=O)c1ccc(Sc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26N2O7S2/c1-4-34-26(31)23-18(12-16(2)3)15-36-24(23)27-22(29)14-35-25(30)17-10-11-21(20(13-17)28(32)33)37-19-8-6-5-7-9-19/h5-11,13,15-16H,4,12,14H2,1-3H3,(H,27,29) |
| InChIKey | XAOOWXIRMXOVLH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|