C19H29NO4S2 — CID 39774538
(3S,4R)-N-cyclohexyl-1,1-dioxo-4-(4-propan-2-ylphenyl)sulfonylthiolan-3-amine (PubChem CID 39774538) has the molecular formula C19H29NO4S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (3S,4R)-N-cyclohexyl-1,1-dioxo-4-(4-propan-2-ylphenyl)sulfonylthiolan-3-amine.
| Compound Name | (3S,4R)-N-cyclohexyl-1,1-dioxo-4-(4-propan-2-ylphenyl)sulfonylthiolan-3-amine |
|---|---|
| PubChem CID | 39774538 |
| Molecular Formula | C19H29NO4S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3S,4R)-N-cyclohexyl-1,1-dioxo-4-(4-propan-2-ylphenyl)sulfonylthiolan-3-amine |
| SMILES | CC(C)c1ccc(S(=O)(=O)[C@H]2CS(=O)(=O)C[C@@H]2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H29NO4S2/c1-14(2)15-8-10-17(11-9-15)26(23,24)19-13-25(21,22)12-18(19)20-16-6-4-3-5-7-16/h8-11,14,16,18-20H,3-7,12-13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | SSEXWUCLIYFKCK-OALUTQOASA-N |
| XLogP | 2.67 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |