C17H18ClNO2S — CID 3977466
1-[(3-chlorophenyl)-thiophen-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 3977466) has the molecular formula C17H18ClNO2S and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-thiophen-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-thiophen-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3977466 |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[(3-chlorophenyl)-thiophen-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2cccc(Cl)c2)c2cccs2)C1 |
| InChI | InChI=1S/C17H18ClNO2S/c18-14-6-1-4-12(10-14)16(15-7-3-9-22-15)19-8-2-5-13(11-19)17(20)21/h1,3-4,6-7,9-10,13,16H,2,5,8,11H2,(H,20,21) |
| InChIKey | KCLJRHXYTBCVEX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |