C27H50N4O3 — CID 3978561
N-cyclohexyl-4-[2-(decanoylamino)-3-methylpentanoyl]piperazine-1-carboxamide (PubChem CID 3978561) has the molecular formula C27H50N4O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(decanoylamino)-3-methylpentanoyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[2-(decanoylamino)-3-methylpentanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3978561 |
| Molecular Formula | C27H50N4O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.39 |
| IUPAC Name | N-cyclohexyl-4-[2-(decanoylamino)-3-methylpentanoyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCCCC(=O)NC(C(=O)N1CCN(C(=O)NC2CCCCC2)CC1)C(C)CC |
| InChI | InChI=1S/C27H50N4O3/c1-4-6-7-8-9-10-14-17-24(32)29-25(22(3)5-2)26(33)30-18-20-31(21-19-30)27(34)28-23-15-12-11-13-16-23/h22-23,25H,4-21H2,1-3H3,(H,28,34)(H,29,32) |
| InChIKey | WJZAPXLOMAIBBH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|