C23H23F2N3O2S — CID 3981128
N-(2,4-difluorophenyl)-4-(3-phenylprop-2-enoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 3981128) has the molecular formula C23H23F2N3O2S and a molecular weight of 443.52 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(3-phenylprop-2-enoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(3-phenylprop-2-enoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 3981128 |
| Molecular Formula | C23H23F2N3O2S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(3-phenylprop-2-enoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCC2(CC1)SCCN2C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C23H23F2N3O2S/c24-18-7-8-20(19(25)16-18)26-22(30)27-12-10-23(11-13-27)28(14-15-31-23)21(29)9-6-17-4-2-1-3-5-17/h1-9,16H,10-15H2,(H,26,30) |
| InChIKey | DFOOTCJBYVVWIU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|