C22H28N2O2S — CID 4031387
1-[4-(cyclopentanecarbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-3-phenylprop-2-en-1-one (PubChem CID 4031387) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[4-(cyclopentanecarbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-(cyclopentanecarbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 4031387 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[4-(cyclopentanecarbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1CCC2(CC1)SCCN2C(=O)C1CCCC1 |
| InChI | InChI=1S/C22H28N2O2S/c25-20(11-10-18-6-2-1-3-7-18)23-14-12-22(13-15-23)24(16-17-27-22)21(26)19-8-4-5-9-19/h1-3,6-7,10-11,19H,4-5,8-9,12-17H2 |
| InChIKey | DVTYVKBGNLNYLP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|