C15H14N2O3S — CID 3982635
N-(4-nitrophenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 3982635) has the molecular formula C15H14N2O3S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | N-(4-nitrophenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 3982635 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(4-nitrophenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1scc2c1CCCC2 |
| InChI | InChI=1S/C15H14N2O3S/c18-15(14-13-4-2-1-3-10(13)9-21-14)16-11-5-7-12(8-6-11)17(19)20/h5-9H,1-4H2,(H,16,18) |
| InChIKey | KLQPSJUIBCHSMF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|