C3H2N4O2S2 — CID 39846529
N-diazo-1,3-thiazole-2-sulfonamide (PubChem CID 39846529) has the molecular formula C3H2N4O2S2 and a molecular weight of 190.21 g/mol. Its IUPAC name is N-diazo-1,3-thiazole-2-sulfonamide.
| Compound Name | N-diazo-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 39846529 |
| Molecular Formula | C3H2N4O2S2 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | N-diazo-1,3-thiazole-2-sulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1nccs1 |
| InChI | InChI=1S/C3H2N4O2S2/c4-6-7-11(8,9)3-5-1-2-10-3/h1-2H |
| InChIKey | RMNBGQUABAFVDX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|