C33H37FN4O6 — CID 3985151
N-[[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide (PubChem CID 3985151) has the molecular formula C33H37FN4O6 and a molecular weight of 604.68 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide.
| Compound Name | N-[[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 3985151 |
| Molecular Formula | C33H37FN4O6 |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | N-[[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
| SMILES | C=CCc1cc(C=NNC(=O)C(C(=O)Nc2ccc(OC)cc2)C(C)C)cc(OCC)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C33H37FN4O6/c1-6-8-23-17-22(18-28(43-7-2)31(23)44-20-29(39)36-25-11-9-24(34)10-12-25)19-35-38-33(41)30(21(3)4)32(40)37-26-13-15-27(42-5)16-14-26/h6,9-19,21,30H,1,7-8,20H2,2-5H3,(H,36,39)(H,37,40)(H,38,41) |
| InChIKey | IDWPWGUPTABALS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|