C19H15F2N3O — CID 39854648
3-cyano-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]benzamide (PubChem CID 39854648) has the molecular formula C19H15F2N3O and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-cyano-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 39854648 |
| Molecular Formula | C19H15F2N3O |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-cyano-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]benzamide |
| SMILES | Cc1[nH]c2c(F)cc(F)cc2c1CCNC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H15F2N3O/c1-11-15(16-8-14(20)9-17(21)18(16)24-11)5-6-23-19(25)13-4-2-3-12(7-13)10-22/h2-4,7-9,24H,5-6H2,1H3,(H,23,25) |
| InChIKey | LHVSQJPEHRKKSI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|