C25H22BFN4O2 — CID 89102295
CID 89102295 (PubChem CID 89102295) has the molecular formula C25H22BFN4O2 and a molecular weight of 440.29 g/mol.
| Compound Name | CID 89102295 |
|---|---|
| PubChem CID | 89102295 |
| Molecular Formula | C25H22BFN4O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c2[nH]c(C)c(CCNC(=O)c3ccc(-c4cccc(C(=O)NC)c4)nc3)c2c1 |
| InChI | InChI=1S/C25H22BFN4O2/c1-14-19(20-11-18(26)12-21(27)23(20)31-14)8-9-29-25(33)17-6-7-22(30-13-17)15-4-3-5-16(10-15)24(32)28-2/h3-7,10-13,31H,8-9H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | VCVWUYGABHXZSX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|