C14H17NO6 — CID 3985779
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanedioic acid (PubChem CID 3985779) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanedioic acid.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanedioic acid |
|---|---|
| PubChem CID | 3985779 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanedioic acid |
| SMILES | O=C(O)CCCC(C(=O)O)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C14H17NO6/c16-11(17)7-3-6-10(14(20)21)15-12(18)8-4-1-2-5-9(8)13(15)19/h1-2,8-10H,3-7H2,(H,16,17)(H,20,21) |
| InChIKey | KZYJHLFNRZIPKZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|