C17H17Cl2N5O — CID 39860820
N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-ethyltetrazol-5-amine (PubChem CID 39860820) has the molecular formula C17H17Cl2N5O and a molecular weight of 378.26 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-ethyltetrazol-5-amine.
| Compound Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 39860820 |
| Molecular Formula | C17H17Cl2N5O |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-ethyltetrazol-5-amine |
| SMILES | CCn1nnc(NCc2cc(Cl)ccc2OCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H17Cl2N5O/c1-2-24-22-17(21-23-24)20-10-13-9-15(19)7-8-16(13)25-11-12-3-5-14(18)6-4-12/h3-9H,2,10-11H2,1H3,(H,20,22) |
| InChIKey | ODSADWQCAKGOEO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |