C27H24N4O4 — CID 39868619
(3R)-1-[(4-methoxyphenyl)methyl]-2-oxo-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 39868619) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is (3R)-1-[(4-methoxyphenyl)methyl]-2-oxo-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-methoxyphenyl)methyl]-2-oxo-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39868619 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (3R)-1-[(4-methoxyphenyl)methyl]-2-oxo-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CN2CC[C@H](C(=O)Nc3ccc(-c4nc(-c5ccccc5)no4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H24N4O4/c1-34-22-13-7-18(8-14-22)17-31-16-15-23(27(31)33)25(32)28-21-11-9-20(10-12-21)26-29-24(30-35-26)19-5-3-2-4-6-19/h2-14,23H,15-17H2,1H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | PAZPDMCCBYGONV-HSZRJFAPSA-N |
| XLogP | 4.40 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|