C20H26N2O4S — CID 39871766
N-ethyl-2-[3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]acetamide (PubChem CID 39871766) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-ethyl-2-[3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 39871766 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-ethyl-2-[3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1cccc(NS(=O)(=O)c2c(C)c(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-6-21-19(23)12-26-18-9-7-8-17(11-18)22-27(24,25)20-15(4)13(2)10-14(3)16(20)5/h7-11,22H,6,12H2,1-5H3,(H,21,23) |
| InChIKey | SIMPSVIRDNOQDU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |