C18H20N2O5S — CID 39871916
2-[3-[(3-acetylphenyl)sulfonylamino]phenoxy]-N-ethylacetamide (PubChem CID 39871916) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[3-[(3-acetylphenyl)sulfonylamino]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[3-[(3-acetylphenyl)sulfonylamino]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 39871916 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[3-[(3-acetylphenyl)sulfonylamino]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cccc(NS(=O)(=O)c2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-3-19-18(22)12-25-16-8-5-7-15(11-16)20-26(23,24)17-9-4-6-14(10-17)13(2)21/h4-11,20H,3,12H2,1-2H3,(H,19,22) |
| InChIKey | SLCCWRNIZOFVSW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |