C18H28N2O4S — CID 71912046
2-[3-[(4,4-dimethylcyclohexyl)sulfonylamino]phenoxy]-N-ethylacetamide (PubChem CID 71912046) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[3-[(4,4-dimethylcyclohexyl)sulfonylamino]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[3-[(4,4-dimethylcyclohexyl)sulfonylamino]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 71912046 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[3-[(4,4-dimethylcyclohexyl)sulfonylamino]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cccc(NS(=O)(=O)C2CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-4-19-17(21)13-24-15-7-5-6-14(12-15)20-25(22,23)16-8-10-18(2,3)11-9-16/h5-7,12,16,20H,4,8-11,13H2,1-3H3,(H,19,21) |
| InChIKey | GFBMZPUBOMTYNO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |