C17H23N3O5 — CID 122075521
1-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122075521) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122075521 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCNC(=O)COc1cccc(NC(=O)N2CCC(C)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C17H23N3O5/c1-3-18-14(21)10-25-13-6-4-5-12(9-13)19-16(24)20-8-7-17(2,11-20)15(22)23/h4-6,9H,3,7-8,10-11H2,1-2H3,(H,18,21)(H,19,24)(H,22,23) |
| InChIKey | HRMRTXNAYWBQPP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |