C23H24N8O3S — CID 3987238
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxyphenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide (PubChem CID 3987238) has the molecular formula C23H24N8O3S and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxyphenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxyphenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3987238 |
| Molecular Formula | C23H24N8O3S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxyphenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide |
| SMILES | CCOc1ccc(C(C)=NNC(=O)c2nnn(-c3nonc3N)c2CSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H24N8O3S/c1-4-33-17-9-7-16(8-10-17)15(3)25-27-23(32)20-19(13-35-18-11-5-14(2)6-12-18)31(30-26-20)22-21(24)28-34-29-22/h5-12H,4,13H2,1-3H3,(H2,24,28)(H,27,32) |
| InChIKey | YJRSNBXLIRVBFS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|