C22H19N9O2S — CID 6140885
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-cyanophenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide (PubChem CID 6140885) has the molecular formula C22H19N9O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-cyanophenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-cyanophenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6140885 |
| Molecular Formula | C22H19N9O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-cyanophenyl)ethylideneamino]-5-[(4-methylphenyl)sulfanylmethyl]triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nnn(-c2nonc2N)c1CSc1ccc(C)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H19N9O2S/c1-13-3-9-17(10-4-13)34-12-18-19(26-30-31(18)21-20(24)28-33-29-21)22(32)27-25-14(2)16-7-5-15(11-23)6-8-16/h3-10H,12H2,1-2H3,(H2,24,28)(H,27,32)/b25-14- |
| InChIKey | IIIPLJXFIDYVAL-QFEZKATASA-N |
| XLogP | 2.86 |
| TPSA | 160.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|