C21H22FNO5S — CID 39877190
N-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide (PubChem CID 39877190) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide.
| Compound Name | N-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39877190 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-(2-methoxyethoxy)-3-methylbenzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N(Cc2ccco2)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C21H22FNO5S/c1-16-14-20(9-10-21(16)28-13-12-26-2)29(24,25)23(15-19-4-3-11-27-19)18-7-5-17(22)6-8-18/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | QFMVTFIFBVZJOI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|