C18H19ClN2O3 — CID 39889978
(1R)-2-(4-chloroindol-1-yl)-1-(2,4-dimethoxyanilino)ethanol (PubChem CID 39889978) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (1R)-2-(4-chloroindol-1-yl)-1-(2,4-dimethoxyanilino)ethanol.
| Compound Name | (1R)-2-(4-chloroindol-1-yl)-1-(2,4-dimethoxyanilino)ethanol |
|---|---|
| PubChem CID | 39889978 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (1R)-2-(4-chloroindol-1-yl)-1-(2,4-dimethoxyanilino)ethanol |
| SMILES | COc1ccc(N[C@H](O)Cn2ccc3c(Cl)cccc32)c(OC)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-23-12-6-7-15(17(10-12)24-2)20-18(22)11-21-9-8-13-14(19)4-3-5-16(13)21/h3-10,18,20,22H,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | ODCDQZKFHNNGEN-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 55.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|