C18H22N2O6 — CID 39890109
methyl (2R)-2-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-methylbutanoate (PubChem CID 39890109) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 39890109 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl (2R)-2-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-methylbutanoate |
| SMILES | COCCN1C(=O)c2ccc(C(=O)N[C@@H](C(=O)OC)C(C)C)cc2C1=O |
| InChI | InChI=1S/C18H22N2O6/c1-10(2)14(18(24)26-4)19-15(21)11-5-6-12-13(9-11)17(23)20(16(12)22)7-8-25-3/h5-6,9-10,14H,7-8H2,1-4H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | NWVAJIQUVMQLKL-CQSZACIVSA-N |
| XLogP | 0.86 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|