C17H13BrClNO2 — CID 3990378
3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile (PubChem CID 3990378) has the molecular formula C17H13BrClNO2 and a molecular weight of 378.65 g/mol. Its IUPAC name is 3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3990378 |
| Molecular Formula | C17H13BrClNO2 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=CC#N)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C17H13BrClNO2/c1-21-16-9-12(6-4-8-20)14(18)10-17(16)22-11-13-5-2-3-7-15(13)19/h2-7,9-10H,11H2,1H3 |
| InChIKey | VORJLFPEVRKZMS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|