C20H23N3O4 — CID 3990860
N'-[3-(3-nitrophenyl)prop-2-enoyl]adamantane-1-carbohydrazide (PubChem CID 3990860) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-[3-(3-nitrophenyl)prop-2-enoyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[3-(3-nitrophenyl)prop-2-enoyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 3990860 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N'-[3-(3-nitrophenyl)prop-2-enoyl]adamantane-1-carbohydrazide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H23N3O4/c24-18(5-4-13-2-1-3-17(9-13)23(26)27)21-22-19(25)20-10-14-6-15(11-20)8-16(7-14)12-20/h1-5,9,14-16H,6-8,10-12H2,(H,21,24)(H,22,25) |
| InChIKey | UERNETXEJQEEJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|