C19H21FN2O6S — CID 39935689
ethyl 5-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 39935689) has the molecular formula C19H21FN2O6S and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 5-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 39935689 |
| Molecular Formula | C19H21FN2O6S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | ethyl 5-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(C)c(F)c3)CC2)o1 |
| InChI | InChI=1S/C19H21FN2O6S/c1-3-27-19(24)16-6-7-17(28-16)29(25,26)22-10-8-21(9-11-22)18(23)14-5-4-13(2)15(20)12-14/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | NIROGJSUFAHLAJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |