C15H24N2O3 — CID 39966099
ethyl 4-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]piperidine-1-carboxylate (PubChem CID 39966099) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39966099 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | ethyl 4-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C[C@H]2C=CCC2)CC1 |
| InChI | InChI=1S/C15H24N2O3/c1-2-20-15(19)17-9-7-13(8-10-17)16-14(18)11-12-5-3-4-6-12/h3,5,12-13H,2,4,6-11H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | WHGATMHFBPXLRW-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|