C22H23FN2O4S — CID 39968307
(2R)-2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-4-methylsulfanylbutanamide (PubChem CID 39968307) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 39968307 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-4-methylsulfanylbutanamide |
| SMILES | COc1ccc([C@H](C)NC(=O)[C@@H](CCSC)N2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C22H23FN2O4S/c1-13(14-8-9-19(29-2)17(23)12-14)24-20(26)18(10-11-30-3)25-21(27)15-6-4-5-7-16(15)22(25)28/h4-9,12-13,18H,10-11H2,1-3H3,(H,24,26)/t13-,18+/m0/s1 |
| InChIKey | WLKCLNOVYDEETH-SCLBCKFNSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|