C15H13BrN2O2 — CID 3997018
4-bromo-2-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 3997018) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is 4-bromo-2-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 4-bromo-2-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 3997018 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-bromo-2-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Cc1ccccc1C1=NC(c2cc(Br)ccc2O)ON1 |
| InChI | InChI=1S/C15H13BrN2O2/c1-9-4-2-3-5-11(9)14-17-15(20-18-14)12-8-10(16)6-7-13(12)19/h2-8,15,19H,1H3,(H,17,18) |
| InChIKey | DMBASUHOFDIBNE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|