C27H29NO4 — CID 3999767
1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3999767) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3999767 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1cc(C(c2ccc(C)cc2)N2CCCC2C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H29NO4/c1-19-10-12-21(13-11-19)26(28-16-6-9-23(28)27(29)30)22-14-15-24(25(17-22)31-2)32-18-20-7-4-3-5-8-20/h3-5,7-8,10-15,17,23,26H,6,9,16,18H2,1-2H3,(H,29,30) |
| InChIKey | MAXNRYQALJUUTR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |