C16H16N4O — CID 39998438
5-methyl-3-[(2R)-1-quinazolin-4-ylpyrrolidin-2-yl]-1,2-oxazole (PubChem CID 39998438) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-methyl-3-[(2R)-1-quinazolin-4-ylpyrrolidin-2-yl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[(2R)-1-quinazolin-4-ylpyrrolidin-2-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 39998438 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-methyl-3-[(2R)-1-quinazolin-4-ylpyrrolidin-2-yl]-1,2-oxazole |
| SMILES | Cc1cc([C@H]2CCCN2c2ncnc3ccccc23)no1 |
| InChI | InChI=1S/C16H16N4O/c1-11-9-14(19-21-11)15-7-4-8-20(15)16-12-5-2-3-6-13(12)17-10-18-16/h2-3,5-6,9-10,15H,4,7-8H2,1H3/t15-/m1/s1 |
| InChIKey | VEUDMNYMHGUPCS-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |