C21H21N3O5S — CID 4001566
[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzamidopropanoate (PubChem CID 4001566) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is [2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzamidopropanoate.
| Compound Name | [2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzamidopropanoate |
|---|---|
| PubChem CID | 4001566 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzamidopropanoate |
| SMILES | CCOc1ccc2nc(NC(=O)COC(=O)C(C)NC(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C21H21N3O5S/c1-3-28-15-9-10-16-17(11-15)30-21(23-16)24-18(25)12-29-20(27)13(2)22-19(26)14-7-5-4-6-8-14/h4-11,13H,3,12H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | LMMVBWFLVOGSFM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |