C23H23ClN2O3 — CID 4002320
1-[(5-chloro-2-methoxyphenyl)-quinolin-4-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 4002320) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-quinolin-4-ylmethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-quinolin-4-ylmethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4002320 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-quinolin-4-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1ccnc2ccccc12)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C23H23ClN2O3/c1-29-21-10-9-15(24)14-18(21)22(26-13-5-4-8-20(26)23(27)28)17-11-12-25-19-7-3-2-6-16(17)19/h2-3,6-7,9-12,14,20,22H,4-5,8,13H2,1H3,(H,27,28) |
| InChIKey | GQXRGIHDFDVDEH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |