C17H15BrN2O3S2 — CID 4009019
4-bromo-N-(5,5-dimethyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)benzenesulfonamide (PubChem CID 4009019) has the molecular formula C17H15BrN2O3S2 and a molecular weight of 439.36 g/mol. Its IUPAC name is 4-bromo-N-(5,5-dimethyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)benzenesulfonamide.
| Compound Name | 4-bromo-N-(5,5-dimethyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 4009019 |
| Molecular Formula | C17H15BrN2O3S2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 4-bromo-N-(5,5-dimethyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)benzenesulfonamide |
| SMILES | CC1(C)SC(=NS(=O)(=O)c2ccc(Br)cc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H15BrN2O3S2/c1-17(2)15(21)20(13-6-4-3-5-7-13)16(24-17)19-25(22,23)14-10-8-12(18)9-11-14/h3-11H,1-2H3 |
| InChIKey | UXQZHVOVZRBZER-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|