C3H6N2O2 — CID 401
4-amino-1,2-oxazolidin-3-one (PubChem CID 401) has the molecular formula C3H6N2O2 and a molecular weight of 102.09 g/mol. Its IUPAC name is 4-amino-1,2-oxazolidin-3-one.
| Compound Name | 4-amino-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 401 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | 4-amino-1,2-oxazolidin-3-one |
| SMILES | NC1CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6) |
| InChIKey | DYDCUQKUCUHJBH-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |