C30H29N4O3+ — CID 4011313
3-[2-(2,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-4-(3,5-dimethylpyridin-1-ium-1-yl)-1-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 4011313) has the molecular formula C30H29N4O3+ and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-[2-(2,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-4-(3,5-dimethylpyridin-1-ium-1-yl)-1-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(2,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-4-(3,5-dimethylpyridin-1-ium-1-yl)-1-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 4011313 |
| Molecular Formula | C30H29N4O3+ |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 3-[2-(2,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-4-(3,5-dimethylpyridin-1-ium-1-yl)-1-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(c3c(C)[nH]n(-c4ccc(C)cc4C)c3=O)=C([n+]3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H28N4O3/c1-17-7-10-23(11-8-17)33-28(35)26(27(30(33)37)32-15-19(3)13-20(4)16-32)25-22(6)31-34(29(25)36)24-12-9-18(2)14-21(24)5/h7-16H,1-6H3/p+1 |
| InChIKey | ZKZBKBUYEVPUPR-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|