C28H25N4O4+ — CID 3876236
3-(3,4-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)pyrrole-2,5-dione (PubChem CID 3876236) has the molecular formula C28H25N4O4+ and a molecular weight of 481.53 g/mol. Its IUPAC name is 3-(3,4-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 3876236 |
| Molecular Formula | C28H25N4O4+ |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 3-(3,4-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(c3c(C)[nH]n(-c4ccccc4)c3=O)=C([n+]3ccc(C)c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H24N4O4/c1-17-14-15-30(16-18(17)2)25-24(23-19(3)29-32(27(23)34)21-8-6-5-7-9-21)26(33)31(28(25)35)20-10-12-22(36-4)13-11-20/h5-16H,1-4H3/p+1 |
| InChIKey | UVAIKTYEYZXQJV-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 88.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|