C27H21N4O5+ — CID 3278831
1-(1,3-benzodioxol-5-yl)-3-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione (PubChem CID 3278831) has the molecular formula C27H21N4O5+ and a molecular weight of 481.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 3278831 |
| Molecular Formula | C27H21N4O5+ |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1cc[n+](C2=C(c3c(C)[nH]n(-c4ccccc4)c3=O)C(=O)N(c3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C27H20N4O5/c1-16-10-12-29(13-11-16)24-23(22-17(2)28-31(26(22)33)18-6-4-3-5-7-18)25(32)30(27(24)34)19-8-9-20-21(14-19)36-15-35-20/h3-14H,15H2,1-2H3/p+1 |
| InChIKey | HACAZLUXGPYIEG-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|