C15H17Br2N3O2 — CID 4011928
N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]heptanamide (PubChem CID 4011928) has the molecular formula C15H17Br2N3O2 and a molecular weight of 431.13 g/mol. Its IUPAC name is N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]heptanamide.
| Compound Name | N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]heptanamide |
|---|---|
| PubChem CID | 4011928 |
| Molecular Formula | C15H17Br2N3O2 |
| Molecular Weight | 431.13 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]heptanamide |
| SMILES | CCCCCCC(=O)/N=N/c1c(O)[nH]c2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C15H17Br2N3O2/c1-2-3-4-5-6-12(21)19-20-14-10-7-9(16)8-11(17)13(10)18-15(14)22/h7-8,18,22H,2-6H2,1H3/b20-19+ |
| InChIKey | USEBHOYITXTIFV-FMQUCBEESA-N |
| XLogP | 5.98 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.13 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|